C18H28N2O2S — CID 49056121
2-cyclopentyloxy-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]acetamide (PubChem CID 49056121) has the molecular formula C18H28N2O2S and a molecular weight of 336.50 g/mol. Its IUPAC name is 2-cyclopentyloxy-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]acetamide.
| Compound Name | 2-cyclopentyloxy-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 49056121 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 2-cyclopentyloxy-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]acetamide |
| SMILES | O=C(COC1CCCC1)NCC1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C18H28N2O2S/c21-18(14-22-16-4-1-2-5-16)19-12-15-7-9-20(10-8-15)13-17-6-3-11-23-17/h3,6,11,15-16H,1-2,4-5,7-10,12-14H2,(H,19,21) |
| InChIKey | GVTQTMYWIFOJKS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |