C18H20FN3O5 — CID 4896502
5'-fluoro-1-(1-hydroxyethyl)-5-(2-methoxyethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 4896502) has the molecular formula C18H20FN3O5 and a molecular weight of 377.37 g/mol. Its IUPAC name is 5'-fluoro-1-(1-hydroxyethyl)-5-(2-methoxyethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | 5'-fluoro-1-(1-hydroxyethyl)-5-(2-methoxyethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 4896502 |
| Molecular Formula | C18H20FN3O5 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 5'-fluoro-1-(1-hydroxyethyl)-5-(2-methoxyethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | COCCN1C(=O)C2C(C(C)O)NC3(C(=O)Nc4ccc(F)cc43)C2C1=O |
| InChI | InChI=1S/C18H20FN3O5/c1-8(23)14-12-13(16(25)22(15(12)24)5-6-27-2)18(21-14)10-7-9(19)3-4-11(10)20-17(18)26/h3-4,7-8,12-14,21,23H,5-6H2,1-2H3,(H,20,26) |
| InChIKey | DIQKBRZOZFXDEA-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|