C19H22FN3O4 — CID 7693441
(1S,3R,3aR,6aS)-5-butyl-5'-fluoro-1-[(1R)-1-hydroxyethyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 7693441) has the molecular formula C19H22FN3O4 and a molecular weight of 375.40 g/mol. Its IUPAC name is (1S,3R,3aR,6aS)-5-butyl-5'-fluoro-1-[(1R)-1-hydroxyethyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1S,3R,3aR,6aS)-5-butyl-5'-fluoro-1-[(1R)-1-hydroxyethyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 7693441 |
| Molecular Formula | C19H22FN3O4 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (1S,3R,3aR,6aS)-5-butyl-5'-fluoro-1-[(1R)-1-hydroxyethyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | CCCCN1C(=O)[C@@H]2[C@@H]([C@@H](C)O)N[C@]3(C(=O)Nc4ccc(F)cc43)[C@@H]2C1=O |
| InChI | InChI=1S/C19H22FN3O4/c1-3-4-7-23-16(25)13-14(17(23)26)19(22-15(13)9(2)24)11-8-10(20)5-6-12(11)21-18(19)27/h5-6,8-9,13-15,22,24H,3-4,7H2,1-2H3,(H,21,27)/t9-,13+,14+,15-,19+/m1/s1 |
| InChIKey | QVYSYXNAPWSMPT-PLDRTOJQSA-N |
| XLogP | 0.73 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|