C26H25N5O4 — CID 4897337
2-(4-nitrophenoxy)-N-[2-(1-phenylethyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-8-yl]acetamide (PubChem CID 4897337) has the molecular formula C26H25N5O4 and a molecular weight of 471.52 g/mol. Its IUPAC name is 2-(4-nitrophenoxy)-N-[2-(1-phenylethyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-8-yl]acetamide.
| Compound Name | 2-(4-nitrophenoxy)-N-[2-(1-phenylethyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-8-yl]acetamide |
|---|---|
| PubChem CID | 4897337 |
| Molecular Formula | C26H25N5O4 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 2-(4-nitrophenoxy)-N-[2-(1-phenylethyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazol-8-yl]acetamide |
| SMILES | CC(c1ccccc1)N1CCn2c(nc3cc(NC(=O)COc4ccc([N+](=O)[O-])cc4)ccc32)C1 |
| InChI | InChI=1S/C26H25N5O4/c1-18(19-5-3-2-4-6-19)29-13-14-30-24-12-7-20(15-23(24)28-25(30)16-29)27-26(32)17-35-22-10-8-21(9-11-22)31(33)34/h2-12,15,18H,13-14,16-17H2,1H3,(H,27,32) |
| InChIKey | KRXSUNIDKLMXGS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|