C21H24N5O4+ — CID 7008738
N-[1-methyl-2-(pyrrolidin-1-ium-1-ylmethyl)benzimidazol-5-yl]-2-(4-nitrophenoxy)acetamide (PubChem CID 7008738) has the molecular formula C21H24N5O4+ and a molecular weight of 410.45 g/mol. Its IUPAC name is N-[1-methyl-2-(pyrrolidin-1-ium-1-ylmethyl)benzimidazol-5-yl]-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[1-methyl-2-(pyrrolidin-1-ium-1-ylmethyl)benzimidazol-5-yl]-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 7008738 |
| Molecular Formula | C21H24N5O4+ |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N-[1-methyl-2-(pyrrolidin-1-ium-1-ylmethyl)benzimidazol-5-yl]-2-(4-nitrophenoxy)acetamide |
| SMILES | Cn1c(C[NH+]2CCCC2)nc2cc(NC(=O)COc3ccc([N+](=O)[O-])cc3)ccc21 |
| InChI | InChI=1S/C21H23N5O4/c1-24-19-9-4-15(12-18(19)23-20(24)13-25-10-2-3-11-25)22-21(27)14-30-17-7-5-16(6-8-17)26(28)29/h4-9,12H,2-3,10-11,13-14H2,1H3,(H,22,27)/p+1 |
| InChIKey | WRSIRGMQCLTABN-UHFFFAOYSA-O |
| XLogP | 1.68 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|