C22H26N4O4 — CID 60606989
N-[1-[2-(diethylamino)ethyl]indol-5-yl]-2-(4-nitrophenoxy)acetamide (PubChem CID 60606989) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is N-[1-[2-(diethylamino)ethyl]indol-5-yl]-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[1-[2-(diethylamino)ethyl]indol-5-yl]-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 60606989 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-[1-[2-(diethylamino)ethyl]indol-5-yl]-2-(4-nitrophenoxy)acetamide |
| SMILES | CCN(CC)CCn1ccc2cc(NC(=O)COc3ccc([N+](=O)[O-])cc3)ccc21 |
| InChI | InChI=1S/C22H26N4O4/c1-3-24(4-2)13-14-25-12-11-17-15-18(5-10-21(17)25)23-22(27)16-30-20-8-6-19(7-9-20)26(28)29/h5-12,15H,3-4,13-14,16H2,1-2H3,(H,23,27) |
| InChIKey | TZRDYCQIYNTVKN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 89.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|