C25H25N3O4 — CID 4899443
2-(7-methoxy-4,8-dimethyl-2-oxochromen-3-yl)-N-[5-methyl-1-(4-methylphenyl)pyrazol-3-yl]acetamide (PubChem CID 4899443) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is 2-(7-methoxy-4,8-dimethyl-2-oxochromen-3-yl)-N-[5-methyl-1-(4-methylphenyl)pyrazol-3-yl]acetamide.
| Compound Name | 2-(7-methoxy-4,8-dimethyl-2-oxochromen-3-yl)-N-[5-methyl-1-(4-methylphenyl)pyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 4899443 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 2-(7-methoxy-4,8-dimethyl-2-oxochromen-3-yl)-N-[5-methyl-1-(4-methylphenyl)pyrazol-3-yl]acetamide |
| SMILES | COc1ccc2c(C)c(CC(=O)Nc3cc(C)n(-c4ccc(C)cc4)n3)c(=O)oc2c1C |
| InChI | InChI=1S/C25H25N3O4/c1-14-6-8-18(9-7-14)28-15(2)12-22(27-28)26-23(29)13-20-16(3)19-10-11-21(31-5)17(4)24(19)32-25(20)30/h6-12H,13H2,1-5H3,(H,26,27,29) |
| InChIKey | DMUHYPWCQZMPMU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|