C18H19N3O5 — CID 4899625
methyl 6-[(3-methylphenyl)carbamoyl]-1,8-dioxo-3,4,6,7-tetrahydro-2H-pyrido[1,2-a]pyrazine-9-carboxylate (PubChem CID 4899625) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is methyl 6-[(3-methylphenyl)carbamoyl]-1,8-dioxo-3,4,6,7-tetrahydro-2H-pyrido[1,2-a]pyrazine-9-carboxylate.
| Compound Name | methyl 6-[(3-methylphenyl)carbamoyl]-1,8-dioxo-3,4,6,7-tetrahydro-2H-pyrido[1,2-a]pyrazine-9-carboxylate |
|---|---|
| PubChem CID | 4899625 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | methyl 6-[(3-methylphenyl)carbamoyl]-1,8-dioxo-3,4,6,7-tetrahydro-2H-pyrido[1,2-a]pyrazine-9-carboxylate |
| SMILES | COC(=O)C1=C2C(=O)NCCN2C(C(=O)Nc2cccc(C)c2)CC1=O |
| InChI | InChI=1S/C18H19N3O5/c1-10-4-3-5-11(8-10)20-16(23)12-9-13(22)14(18(25)26-2)15-17(24)19-6-7-21(12)15/h3-5,8,12H,6-7,9H2,1-2H3,(H,19,24)(H,20,23) |
| InChIKey | XHPSUZNLFYQMNM-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|