C19H17N3O4 — CID 4901592
N-(2,1,3-benzoxadiazol-4-yl)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)but-2-enamide (PubChem CID 4901592) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is N-(2,1,3-benzoxadiazol-4-yl)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)but-2-enamide.
| Compound Name | N-(2,1,3-benzoxadiazol-4-yl)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)but-2-enamide |
|---|---|
| PubChem CID | 4901592 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-(2,1,3-benzoxadiazol-4-yl)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)but-2-enamide |
| SMILES | CC(=CC(=O)Nc1cccc2nonc12)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C19H17N3O4/c1-12(13-6-7-16-17(11-13)25-9-3-8-24-16)10-18(23)20-14-4-2-5-15-19(14)22-26-21-15/h2,4-7,10-11H,3,8-9H2,1H3,(H,20,23) |
| InChIKey | ROUMTNILHCREFB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|