C22H29N3O5 — CID 4903125
ethyl 4-[2-oxo-4-[(1-oxo-1-piperidin-1-ylpropan-2-yl)carbamoyl]pyrrolidin-1-yl]benzoate (PubChem CID 4903125) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is ethyl 4-[2-oxo-4-[(1-oxo-1-piperidin-1-ylpropan-2-yl)carbamoyl]pyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[2-oxo-4-[(1-oxo-1-piperidin-1-ylpropan-2-yl)carbamoyl]pyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 4903125 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | ethyl 4-[2-oxo-4-[(1-oxo-1-piperidin-1-ylpropan-2-yl)carbamoyl]pyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2CC(C(=O)NC(C)C(=O)N3CCCCC3)CC2=O)cc1 |
| InChI | InChI=1S/C22H29N3O5/c1-3-30-22(29)16-7-9-18(10-8-16)25-14-17(13-19(25)26)20(27)23-15(2)21(28)24-11-5-4-6-12-24/h7-10,15,17H,3-6,11-14H2,1-2H3,(H,23,27) |
| InChIKey | DONYEKFBTAYVLB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |