C18H23N3O4 — CID 108791060
2-[[5-oxo-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carbonyl]amino]propanoic acid (PubChem CID 108791060) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-[[5-oxo-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carbonyl]amino]propanoic acid.
| Compound Name | 2-[[5-oxo-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 108791060 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-[[5-oxo-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carbonyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C1CC(=O)N(c2ccc(N3CCCC3)cc2)C1)C(=O)O |
| InChI | InChI=1S/C18H23N3O4/c1-12(18(24)25)19-17(23)13-10-16(22)21(11-13)15-6-4-14(5-7-15)20-8-2-3-9-20/h4-7,12-13H,2-3,8-11H2,1H3,(H,19,23)(H,24,25) |
| InChIKey | GQXJHAOKXCFRHW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|