C19H23N3O6 — CID 108791082
2-[[5-oxo-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carbonyl]amino]butanedioic acid (PubChem CID 108791082) has the molecular formula C19H23N3O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is 2-[[5-oxo-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carbonyl]amino]butanedioic acid.
| Compound Name | 2-[[5-oxo-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carbonyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 108791082 |
| Molecular Formula | C19H23N3O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 2-[[5-oxo-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carbonyl]amino]butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)C1CC(=O)N(c2ccc(N3CCCC3)cc2)C1)C(=O)O |
| InChI | InChI=1S/C19H23N3O6/c23-16-9-12(18(26)20-15(19(27)28)10-17(24)25)11-22(16)14-5-3-13(4-6-14)21-7-1-2-8-21/h3-6,12,15H,1-2,7-11H2,(H,20,26)(H,24,25)(H,27,28) |
| InChIKey | SNCNNKIEHRCCJI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|