C14H15ClN2O5 — CID 108800085
2-[[1-(4-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-hydroxypropanoic acid (PubChem CID 108800085) has the molecular formula C14H15ClN2O5 and a molecular weight of 326.74 g/mol. Its IUPAC name is 2-[[1-(4-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[1-(4-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 108800085 |
| Molecular Formula | C14H15ClN2O5 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 2-[[1-(4-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]-3-hydroxypropanoic acid |
| SMILES | O=C(NC(CO)C(=O)O)C1CC(=O)N(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C14H15ClN2O5/c15-9-1-3-10(4-2-9)17-6-8(5-12(17)19)13(20)16-11(7-18)14(21)22/h1-4,8,11,18H,5-7H2,(H,16,20)(H,21,22) |
| InChIKey | CTIYQYLJWGBPEP-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |