C17H21ClN2O6S — CID 108800173
2-[[1-(4-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-ethylsulfonylbutanoic acid (PubChem CID 108800173) has the molecular formula C17H21ClN2O6S and a molecular weight of 416.88 g/mol. Its IUPAC name is 2-[[1-(4-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-ethylsulfonylbutanoic acid.
| Compound Name | 2-[[1-(4-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-ethylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 108800173 |
| Molecular Formula | C17H21ClN2O6S |
| Molecular Weight | 416.88 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 2-[[1-(4-chlorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-ethylsulfonylbutanoic acid |
| SMILES | CCS(=O)(=O)CCC(NC(=O)C1CC(=O)N(c2ccc(Cl)cc2)C1)C(=O)O |
| InChI | InChI=1S/C17H21ClN2O6S/c1-2-27(25,26)8-7-14(17(23)24)19-16(22)11-9-15(21)20(10-11)13-5-3-12(18)4-6-13/h3-6,11,14H,2,7-10H2,1H3,(H,19,22)(H,23,24) |
| InChIKey | UJMRQJLUUFSPRN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.88 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |