C27H27N3O2S — CID 108791087
5-oxo-N-(2-phenylsulfanylphenyl)-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carboxamide (PubChem CID 108791087) has the molecular formula C27H27N3O2S and a molecular weight of 457.60 g/mol. Its IUPAC name is 5-oxo-N-(2-phenylsulfanylphenyl)-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | 5-oxo-N-(2-phenylsulfanylphenyl)-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 108791087 |
| Molecular Formula | C27H27N3O2S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 5-oxo-N-(2-phenylsulfanylphenyl)-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Sc1ccccc1)C1CC(=O)N(c2ccc(N3CCCC3)cc2)C1 |
| InChI | InChI=1S/C27H27N3O2S/c31-26-18-20(19-30(26)22-14-12-21(13-15-22)29-16-6-7-17-29)27(32)28-24-10-4-5-11-25(24)33-23-8-2-1-3-9-23/h1-5,8-15,20H,6-7,16-19H2,(H,28,32) |
| InChIKey | QEZCRFCJUCIDPJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|