C18H20N4O3 — CID 49034903
1-acetyl-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]piperidine-4-carboxamide (PubChem CID 49034903) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-acetyl-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 49034903 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-acetyl-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)Nc2cccc(-c3ccc(=O)[nH]n3)c2)CC1 |
| InChI | InChI=1S/C18H20N4O3/c1-12(23)22-9-7-13(8-10-22)18(25)19-15-4-2-3-14(11-15)16-5-6-17(24)21-20-16/h2-6,11,13H,7-10H2,1H3,(H,19,25)(H,21,24) |
| InChIKey | NXMQNZIARLRDII-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |