C18H17N3O4S — CID 49035754
N-[4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-1-oxidopyridin-1-ium-3-carboxamide (PubChem CID 49035754) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is N-[4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-1-oxidopyridin-1-ium-3-carboxamide.
| Compound Name | N-[4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-1-oxidopyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 49035754 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-[4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-1-oxidopyridin-1-ium-3-carboxamide |
| SMILES | COc1ccc(-c2nc(NC(=O)c3ccc[n+]([O-])c3)sc2C)cc1OC |
| InChI | InChI=1S/C18H17N3O4S/c1-11-16(12-6-7-14(24-2)15(9-12)25-3)19-18(26-11)20-17(22)13-5-4-8-21(23)10-13/h4-10H,1-3H3,(H,19,20,22) |
| InChIKey | SQRJCNXKWSGYKH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|