C15H13N3O4S — CID 24600028
N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-1-oxidopyridin-1-ium-3-carboxamide (PubChem CID 24600028) has the molecular formula C15H13N3O4S and a molecular weight of 331.35 g/mol. Its IUPAC name is N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-1-oxidopyridin-1-ium-3-carboxamide.
| Compound Name | N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-1-oxidopyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 24600028 |
| Molecular Formula | C15H13N3O4S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-1-oxidopyridin-1-ium-3-carboxamide |
| SMILES | COc1cc2nc(NC(=O)c3ccc[n+]([O-])c3)sc2cc1OC |
| InChI | InChI=1S/C15H13N3O4S/c1-21-11-6-10-13(7-12(11)22-2)23-15(16-10)17-14(19)9-4-3-5-18(20)8-9/h3-8H,1-2H3,(H,16,17,19) |
| InChIKey | AOBPGHWDXGOENW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|