C25H26N4O2 — CID 4903980
6-benzyl-12-methyl-5-(2-methylpiperidine-1-carbonyl)-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one (PubChem CID 4903980) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 6-benzyl-12-methyl-5-(2-methylpiperidine-1-carbonyl)-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one.
| Compound Name | 6-benzyl-12-methyl-5-(2-methylpiperidine-1-carbonyl)-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one |
|---|---|
| PubChem CID | 4903980 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 6-benzyl-12-methyl-5-(2-methylpiperidine-1-carbonyl)-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one |
| SMILES | Cc1ccc2nc3c(cc(C(=O)N4CCCCC4C)n3Cc3ccccc3)c(=O)n2c1 |
| InChI | InChI=1S/C25H26N4O2/c1-17-11-12-22-26-23-20(24(30)29(22)15-17)14-21(25(31)27-13-7-6-8-18(27)2)28(23)16-19-9-4-3-5-10-19/h3-5,9-12,14-15,18H,6-8,13,16H2,1-2H3 |
| InChIKey | UVFBQFJRTUPFHQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |