C26H32N6S2 — CID 4904825
[4,6-bis(2-ethylanilino)-1,3,5-triazin-2-yl] 4-methylpiperidine-1-carbodithioate (PubChem CID 4904825) has the molecular formula C26H32N6S2 and a molecular weight of 492.72 g/mol. Its IUPAC name is [4,6-bis(2-ethylanilino)-1,3,5-triazin-2-yl] 4-methylpiperidine-1-carbodithioate.
| Compound Name | [4,6-bis(2-ethylanilino)-1,3,5-triazin-2-yl] 4-methylpiperidine-1-carbodithioate |
|---|---|
| PubChem CID | 4904825 |
| Molecular Formula | C26H32N6S2 |
| Molecular Weight | 492.72 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | [4,6-bis(2-ethylanilino)-1,3,5-triazin-2-yl] 4-methylpiperidine-1-carbodithioate |
| SMILES | CCc1ccccc1Nc1nc(Nc2ccccc2CC)nc(SC(=S)N2CCC(C)CC2)n1 |
| InChI | InChI=1S/C26H32N6S2/c1-4-19-10-6-8-12-21(19)27-23-29-24(28-22-13-9-7-11-20(22)5-2)31-25(30-23)34-26(33)32-16-14-18(3)15-17-32/h6-13,18H,4-5,14-17H2,1-3H3,(H2,27,28,29,30,31) |
| InChIKey | RGQFBYSJKXIEMZ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.72 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|