C20H18F3N3O3 — CID 4905877
N-[1-[2-(4-hydroxyphenyl)ethyl]-5-oxo-2-phenyl-4-(trifluoromethyl)imidazol-4-yl]acetamide (PubChem CID 4905877) has the molecular formula C20H18F3N3O3 and a molecular weight of 405.38 g/mol. Its IUPAC name is N-[1-[2-(4-hydroxyphenyl)ethyl]-5-oxo-2-phenyl-4-(trifluoromethyl)imidazol-4-yl]acetamide.
| Compound Name | N-[1-[2-(4-hydroxyphenyl)ethyl]-5-oxo-2-phenyl-4-(trifluoromethyl)imidazol-4-yl]acetamide |
|---|---|
| PubChem CID | 4905877 |
| Molecular Formula | C20H18F3N3O3 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-[1-[2-(4-hydroxyphenyl)ethyl]-5-oxo-2-phenyl-4-(trifluoromethyl)imidazol-4-yl]acetamide |
| SMILES | CC(=O)NC1(C(F)(F)F)N=C(c2ccccc2)N(CCc2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C20H18F3N3O3/c1-13(27)24-19(20(21,22)23)18(29)26(12-11-14-7-9-16(28)10-8-14)17(25-19)15-5-3-2-4-6-15/h2-10,28H,11-12H2,1H3,(H,24,27) |
| InChIKey | JPXJGMQFMLWZJD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |