C20H13N5O2 — CID 4906718
5-(2-methylphenyl)-4-(3-nitrophenyl)pyrrolo[3,2-d]pyrimidine-7-carbonitrile (PubChem CID 4906718) has the molecular formula C20H13N5O2 and a molecular weight of 355.36 g/mol. Its IUPAC name is 5-(2-methylphenyl)-4-(3-nitrophenyl)pyrrolo[3,2-d]pyrimidine-7-carbonitrile.
| Compound Name | 5-(2-methylphenyl)-4-(3-nitrophenyl)pyrrolo[3,2-d]pyrimidine-7-carbonitrile |
|---|---|
| PubChem CID | 4906718 |
| Molecular Formula | C20H13N5O2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 5-(2-methylphenyl)-4-(3-nitrophenyl)pyrrolo[3,2-d]pyrimidine-7-carbonitrile |
| SMILES | Cc1ccccc1-n1cc(C#N)c2ncnc(-c3cccc([N+](=O)[O-])c3)c21 |
| InChI | InChI=1S/C20H13N5O2/c1-13-5-2-3-8-17(13)24-11-15(10-21)19-20(24)18(22-12-23-19)14-6-4-7-16(9-14)25(26)27/h2-9,11-12H,1H3 |
| InChIKey | YJJXTSCMODZNJP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 97.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|