C22H16N2O5 — CID 4906873
N-(3-nitrophenyl)-1-oxo-3-phenyl-3,4-dihydroisochromene-6-carboxamide (PubChem CID 4906873) has the molecular formula C22H16N2O5 and a molecular weight of 388.38 g/mol. Its IUPAC name is N-(3-nitrophenyl)-1-oxo-3-phenyl-3,4-dihydroisochromene-6-carboxamide.
| Compound Name | N-(3-nitrophenyl)-1-oxo-3-phenyl-3,4-dihydroisochromene-6-carboxamide |
|---|---|
| PubChem CID | 4906873 |
| Molecular Formula | C22H16N2O5 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-(3-nitrophenyl)-1-oxo-3-phenyl-3,4-dihydroisochromene-6-carboxamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)c1ccc2c(c1)CC(c1ccccc1)OC2=O |
| InChI | InChI=1S/C22H16N2O5/c25-21(23-17-7-4-8-18(13-17)24(27)28)15-9-10-19-16(11-15)12-20(29-22(19)26)14-5-2-1-3-6-14/h1-11,13,20H,12H2,(H,23,25) |
| InChIKey | MAWAZQBWUQGXSM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|