C16H23F2N3O3 — CID 49072325
N-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-(2-methoxyethoxy)pyridine-3-carboxamide (PubChem CID 49072325) has the molecular formula C16H23F2N3O3 and a molecular weight of 343.37 g/mol. Its IUPAC name is N-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-(2-methoxyethoxy)pyridine-3-carboxamide.
| Compound Name | N-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-(2-methoxyethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 49072325 |
| Molecular Formula | C16H23F2N3O3 |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-(2-methoxyethoxy)pyridine-3-carboxamide |
| SMILES | COCCOc1ncccc1C(=O)NC1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C16H23F2N3O3/c1-23-9-10-24-16-13(3-2-6-19-16)15(22)20-12-4-7-21(8-5-12)11-14(17)18/h2-3,6,12,14H,4-5,7-11H2,1H3,(H,20,22) |
| InChIKey | JKCILOKHJBMMMY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|