C22H26BrN3O2 — CID 56569700
2-(4-bromophenoxy)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 56569700) has the molecular formula C22H26BrN3O2 and a molecular weight of 444.37 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | 2-(4-bromophenoxy)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56569700 |
| Molecular Formula | C22H26BrN3O2 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 2-(4-bromophenoxy)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | CC(C)=CCN1CCC(NC(=O)c2cccnc2Oc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C22H26BrN3O2/c1-16(2)9-13-26-14-10-18(11-15-26)25-21(27)20-4-3-12-24-22(20)28-19-7-5-17(23)6-8-19/h3-9,12,18H,10-11,13-15H2,1-2H3,(H,25,27) |
| InChIKey | GKGBURQCVPBIHZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|