C19H16F3NO4 — CID 49089493
N-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-5-methyl-1-benzofuran-2-carboxamide (PubChem CID 49089493) has the molecular formula C19H16F3NO4 and a molecular weight of 379.33 g/mol. Its IUPAC name is N-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-5-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-5-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 49089493 |
| Molecular Formula | C19H16F3NO4 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-5-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc2oc(C(=O)NCC(O)c3ccc(OC(F)(F)F)cc3)cc2c1 |
| InChI | InChI=1S/C19H16F3NO4/c1-11-2-7-16-13(8-11)9-17(26-16)18(25)23-10-15(24)12-3-5-14(6-4-12)27-19(20,21)22/h2-9,15,24H,10H2,1H3,(H,23,25) |
| InChIKey | BPZDRSJFJBSKFK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |