C17H13F2NO3 — CID 111425569
5-fluoro-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-1-benzofuran-2-carboxamide (PubChem CID 111425569) has the molecular formula C17H13F2NO3 and a molecular weight of 317.29 g/mol. Its IUPAC name is 5-fluoro-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-fluoro-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 111425569 |
| Molecular Formula | C17H13F2NO3 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 5-fluoro-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCC(O)c1ccc(F)cc1)c1cc2cc(F)ccc2o1 |
| InChI | InChI=1S/C17H13F2NO3/c18-12-3-1-10(2-4-12)14(21)9-20-17(22)16-8-11-7-13(19)5-6-15(11)23-16/h1-8,14,21H,9H2,(H,20,22) |
| InChIKey | PLGUVSMITHFZQL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |