C16H18FNO4 — CID 111697870
N-[3-(cyclopropylmethoxy)-2-hydroxypropyl]-5-fluoro-1-benzofuran-2-carboxamide (PubChem CID 111697870) has the molecular formula C16H18FNO4 and a molecular weight of 307.32 g/mol. Its IUPAC name is N-[3-(cyclopropylmethoxy)-2-hydroxypropyl]-5-fluoro-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-(cyclopropylmethoxy)-2-hydroxypropyl]-5-fluoro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 111697870 |
| Molecular Formula | C16H18FNO4 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | N-[3-(cyclopropylmethoxy)-2-hydroxypropyl]-5-fluoro-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCC(O)COCC1CC1)c1cc2cc(F)ccc2o1 |
| InChI | InChI=1S/C16H18FNO4/c17-12-3-4-14-11(5-12)6-15(22-14)16(20)18-7-13(19)9-21-8-10-1-2-10/h3-6,10,13,19H,1-2,7-9H2,(H,18,20) |
| InChIKey | HGDPDFNWCGMQDF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |