C16H18N2O4 — CID 49094694
N-[(4-methylmorpholin-2-yl)methyl]-2-oxochromene-3-carboxamide (PubChem CID 49094694) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is N-[(4-methylmorpholin-2-yl)methyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[(4-methylmorpholin-2-yl)methyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 49094694 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N-[(4-methylmorpholin-2-yl)methyl]-2-oxochromene-3-carboxamide |
| SMILES | CN1CCOC(CNC(=O)c2cc3ccccc3oc2=O)C1 |
| InChI | InChI=1S/C16H18N2O4/c1-18-6-7-21-12(10-18)9-17-15(19)13-8-11-4-2-3-5-14(11)22-16(13)20/h2-5,8,12H,6-7,9-10H2,1H3,(H,17,19) |
| InChIKey | OWVVSBBRBVPOFG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|