C17H16N2O3S3 — CID 4910077
N-(5,5-dioxo-3-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene)-2-thiophen-2-ylacetamide (PubChem CID 4910077) has the molecular formula C17H16N2O3S3 and a molecular weight of 392.53 g/mol. Its IUPAC name is N-(5,5-dioxo-3-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene)-2-thiophen-2-ylacetamide.
| Compound Name | N-(5,5-dioxo-3-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 4910077 |
| Molecular Formula | C17H16N2O3S3 |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | N-(5,5-dioxo-3-phenyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene)-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)/N=C1\SC2CS(=O)(=O)CC2N1c1ccccc1 |
| InChI | InChI=1S/C17H16N2O3S3/c20-16(9-13-7-4-8-23-13)18-17-19(12-5-2-1-3-6-12)14-10-25(21,22)11-15(14)24-17/h1-8,14-15H,9-11H2/b18-17- |
| InChIKey | BESUHZGBEDNJHJ-ZCXUNETKSA-N |
| XLogP | 2.59 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|