C17H14F2N2O3S3 — CID 40902884
N-[(3aR,6aS)-3-(2,4-difluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-thiophen-2-ylacetamide (PubChem CID 40902884) has the molecular formula C17H14F2N2O3S3 and a molecular weight of 428.51 g/mol. Its IUPAC name is N-[(3aR,6aS)-3-(2,4-difluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(3aR,6aS)-3-(2,4-difluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 40902884 |
| Molecular Formula | C17H14F2N2O3S3 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | N-[(3aR,6aS)-3-(2,4-difluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)/N=C1\S[C@@H]2CS(=O)(=O)C[C@H]2N1c1ccc(F)cc1F |
| InChI | InChI=1S/C17H14F2N2O3S3/c18-10-3-4-13(12(19)6-10)21-14-8-27(23,24)9-15(14)26-17(21)20-16(22)7-11-2-1-5-25-11/h1-6,14-15H,7-9H2/b20-17-/t14-,15-/m1/s1 |
| InChIKey | PIQOJQXIQSPNEO-FCPHTXGTSA-N |
| XLogP | 2.87 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|