C20H24ClN3OS — CID 49119365
1-[(2-chlorophenyl)methyl]-1-methyl-3-[2-(thiomorpholin-4-ylmethyl)phenyl]urea (PubChem CID 49119365) has the molecular formula C20H24ClN3OS and a molecular weight of 389.95 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-1-methyl-3-[2-(thiomorpholin-4-ylmethyl)phenyl]urea.
| Compound Name | 1-[(2-chlorophenyl)methyl]-1-methyl-3-[2-(thiomorpholin-4-ylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 49119365 |
| Molecular Formula | C20H24ClN3OS |
| Molecular Weight | 389.95 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-1-methyl-3-[2-(thiomorpholin-4-ylmethyl)phenyl]urea |
| SMILES | CN(Cc1ccccc1Cl)C(=O)Nc1ccccc1CN1CCSCC1 |
| InChI | InChI=1S/C20H24ClN3OS/c1-23(14-16-6-2-4-8-18(16)21)20(25)22-19-9-5-3-7-17(19)15-24-10-12-26-13-11-24/h2-9H,10-15H2,1H3,(H,22,25) |
| InChIKey | JWZQBAIGJOLRAP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.95 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |