C19H21FN2OS2 — CID 49004814
2-(4-fluorophenyl)sulfanyl-N-[2-(thiomorpholin-4-ylmethyl)phenyl]acetamide (PubChem CID 49004814) has the molecular formula C19H21FN2OS2 and a molecular weight of 376.52 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfanyl-N-[2-(thiomorpholin-4-ylmethyl)phenyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)sulfanyl-N-[2-(thiomorpholin-4-ylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 49004814 |
| Molecular Formula | C19H21FN2OS2 |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-(4-fluorophenyl)sulfanyl-N-[2-(thiomorpholin-4-ylmethyl)phenyl]acetamide |
| SMILES | O=C(CSc1ccc(F)cc1)Nc1ccccc1CN1CCSCC1 |
| InChI | InChI=1S/C19H21FN2OS2/c20-16-5-7-17(8-6-16)25-14-19(23)21-18-4-2-1-3-15(18)13-22-9-11-24-12-10-22/h1-8H,9-14H2,(H,21,23) |
| InChIKey | BMFAUDXQANYWLV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |