C21H26N2OS2 — CID 47086736
2-(2-methylphenyl)sulfanyl-N-[2-methyl-3-(thiomorpholin-4-ylmethyl)phenyl]acetamide (PubChem CID 47086736) has the molecular formula C21H26N2OS2 and a molecular weight of 386.59 g/mol. Its IUPAC name is 2-(2-methylphenyl)sulfanyl-N-[2-methyl-3-(thiomorpholin-4-ylmethyl)phenyl]acetamide.
| Compound Name | 2-(2-methylphenyl)sulfanyl-N-[2-methyl-3-(thiomorpholin-4-ylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 47086736 |
| Molecular Formula | C21H26N2OS2 |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-(2-methylphenyl)sulfanyl-N-[2-methyl-3-(thiomorpholin-4-ylmethyl)phenyl]acetamide |
| SMILES | Cc1ccccc1SCC(=O)Nc1cccc(CN2CCSCC2)c1C |
| InChI | InChI=1S/C21H26N2OS2/c1-16-6-3-4-9-20(16)26-15-21(24)22-19-8-5-7-18(17(19)2)14-23-10-12-25-13-11-23/h3-9H,10-15H2,1-2H3,(H,22,24) |
| InChIKey | CQQGSNJGBJVGMX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |