C21H27N3OS — CID 119870055
2-amino-N-[2-methyl-3-(thiomorpholin-4-ylmethyl)phenyl]-3-phenylpropanamide (PubChem CID 119870055) has the molecular formula C21H27N3OS and a molecular weight of 369.53 g/mol. Its IUPAC name is 2-amino-N-[2-methyl-3-(thiomorpholin-4-ylmethyl)phenyl]-3-phenylpropanamide.
| Compound Name | 2-amino-N-[2-methyl-3-(thiomorpholin-4-ylmethyl)phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 119870055 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-amino-N-[2-methyl-3-(thiomorpholin-4-ylmethyl)phenyl]-3-phenylpropanamide |
| SMILES | Cc1c(CN2CCSCC2)cccc1NC(=O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C21H27N3OS/c1-16-18(15-24-10-12-26-13-11-24)8-5-9-20(16)23-21(25)19(22)14-17-6-3-2-4-7-17/h2-9,19H,10-15,22H2,1H3,(H,23,25) |
| InChIKey | RGWROTJVUOEGDK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |