C20H24N2O2S — CID 122029757
4-[[2-methyl-3-(thiomorpholin-4-ylmethyl)anilino]methyl]benzoic acid (PubChem CID 122029757) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is 4-[[2-methyl-3-(thiomorpholin-4-ylmethyl)anilino]methyl]benzoic acid.
| Compound Name | 4-[[2-methyl-3-(thiomorpholin-4-ylmethyl)anilino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122029757 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 4-[[2-methyl-3-(thiomorpholin-4-ylmethyl)anilino]methyl]benzoic acid |
| SMILES | Cc1c(CN2CCSCC2)cccc1NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C20H24N2O2S/c1-15-18(14-22-9-11-25-12-10-22)3-2-4-19(15)21-13-16-5-7-17(8-6-16)20(23)24/h2-8,21H,9-14H2,1H3,(H,23,24) |
| InChIKey | OZSSEOJSMBBFIW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |