C18H22N2OS2 — CID 122146673
4-methyl-N-[2-methyl-3-(thiomorpholin-4-ylmethyl)phenyl]thiophene-3-carboxamide (PubChem CID 122146673) has the molecular formula C18H22N2OS2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 4-methyl-N-[2-methyl-3-(thiomorpholin-4-ylmethyl)phenyl]thiophene-3-carboxamide.
| Compound Name | 4-methyl-N-[2-methyl-3-(thiomorpholin-4-ylmethyl)phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 122146673 |
| Molecular Formula | C18H22N2OS2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 4-methyl-N-[2-methyl-3-(thiomorpholin-4-ylmethyl)phenyl]thiophene-3-carboxamide |
| SMILES | Cc1cscc1C(=O)Nc1cccc(CN2CCSCC2)c1C |
| InChI | InChI=1S/C18H22N2OS2/c1-13-11-23-12-16(13)18(21)19-17-5-3-4-15(14(17)2)10-20-6-8-22-9-7-20/h3-5,11-12H,6-10H2,1-2H3,(H,19,21) |
| InChIKey | SMKPRJBFEQDLJT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |