C21H27N3O2S2 — CID 49008672
N-[4-[2-methyl-3-(thiomorpholin-4-ylmethyl)anilino]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 49008672) has the molecular formula C21H27N3O2S2 and a molecular weight of 417.60 g/mol. Its IUPAC name is N-[4-[2-methyl-3-(thiomorpholin-4-ylmethyl)anilino]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[2-methyl-3-(thiomorpholin-4-ylmethyl)anilino]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 49008672 |
| Molecular Formula | C21H27N3O2S2 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[4-[2-methyl-3-(thiomorpholin-4-ylmethyl)anilino]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | Cc1c(CN2CCSCC2)cccc1NC(=O)CCCNC(=O)c1ccsc1 |
| InChI | InChI=1S/C21H27N3O2S2/c1-16-17(14-24-9-12-27-13-10-24)4-2-5-19(16)23-20(25)6-3-8-22-21(26)18-7-11-28-15-18/h2,4-5,7,11,15H,3,6,8-10,12-14H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | OPUFLVMADDWSMY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|