C19H29N3O2S — CID 119870105
4-methoxy-N-[2-methyl-3-(thiomorpholin-4-ylmethyl)phenyl]piperidine-4-carboxamide (PubChem CID 119870105) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is 4-methoxy-N-[2-methyl-3-(thiomorpholin-4-ylmethyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 4-methoxy-N-[2-methyl-3-(thiomorpholin-4-ylmethyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119870105 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 4-methoxy-N-[2-methyl-3-(thiomorpholin-4-ylmethyl)phenyl]piperidine-4-carboxamide |
| SMILES | COC1(C(=O)Nc2cccc(CN3CCSCC3)c2C)CCNCC1 |
| InChI | InChI=1S/C19H29N3O2S/c1-15-16(14-22-10-12-25-13-11-22)4-3-5-17(15)21-18(23)19(24-2)6-8-20-9-7-19/h3-5,20H,6-14H2,1-2H3,(H,21,23) |
| InChIKey | LLBRBCPJEKJAJH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |