C21H22N2O5S — CID 4912713
1-[3-(5-cinnamylidene-2,4-dioxo-1,3-thiazolidin-3-yl)propanoyl]piperidine-4-carboxylic acid (PubChem CID 4912713) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is 1-[3-(5-cinnamylidene-2,4-dioxo-1,3-thiazolidin-3-yl)propanoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-(5-cinnamylidene-2,4-dioxo-1,3-thiazolidin-3-yl)propanoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 4912713 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1-[3-(5-cinnamylidene-2,4-dioxo-1,3-thiazolidin-3-yl)propanoyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)CCN2C(=O)SC(=CC=Cc3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C21H22N2O5S/c24-18(22-12-9-16(10-13-22)20(26)27)11-14-23-19(25)17(29-21(23)28)8-4-7-15-5-2-1-3-6-15/h1-8,16H,9-14H2,(H,26,27) |
| InChIKey | GZWPQYYFQKAFSB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|