C21H15Cl2N3O3 — CID 4914709
6,8-dichloro-N-[1-(4-imidazol-1-ylphenyl)ethyl]-2-oxochromene-3-carboxamide (PubChem CID 4914709) has the molecular formula C21H15Cl2N3O3 and a molecular weight of 428.28 g/mol. Its IUPAC name is 6,8-dichloro-N-[1-(4-imidazol-1-ylphenyl)ethyl]-2-oxochromene-3-carboxamide.
| Compound Name | 6,8-dichloro-N-[1-(4-imidazol-1-ylphenyl)ethyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 4914709 |
| Molecular Formula | C21H15Cl2N3O3 |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | 6,8-dichloro-N-[1-(4-imidazol-1-ylphenyl)ethyl]-2-oxochromene-3-carboxamide |
| SMILES | CC(NC(=O)c1cc2cc(Cl)cc(Cl)c2oc1=O)c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C21H15Cl2N3O3/c1-12(13-2-4-16(5-3-13)26-7-6-24-11-26)25-20(27)17-9-14-8-15(22)10-18(23)19(14)29-21(17)28/h2-12H,1H3,(H,25,27) |
| InChIKey | GTHNIOFPGVTREK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|