C25H24N4O2 — CID 4915544
ethyl 2-[4-[N'-(2-phenylethyl)carbamimidoyl]phenyl]-3H-benzimidazole-5-carboxylate (PubChem CID 4915544) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is ethyl 2-[4-[N'-(2-phenylethyl)carbamimidoyl]phenyl]-3H-benzimidazole-5-carboxylate.
| Compound Name | ethyl 2-[4-[N'-(2-phenylethyl)carbamimidoyl]phenyl]-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 4915544 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | ethyl 2-[4-[N'-(2-phenylethyl)carbamimidoyl]phenyl]-3H-benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(-c3ccc(/C(N)=N/CCc4ccccc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C25H24N4O2/c1-2-31-25(30)20-12-13-21-22(16-20)29-24(28-21)19-10-8-18(9-11-19)23(26)27-15-14-17-6-4-3-5-7-17/h3-13,16H,2,14-15H2,1H3,(H2,26,27)(H,28,29) |
| InChIKey | UQDFSCCALNRNFG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|