C30H24N2O2 — CID 4916628
2-dibenzofuran-2-yl-4-(3-methylanilino)-1-(3-methylphenyl)-2H-pyrrol-5-one (PubChem CID 4916628) has the molecular formula C30H24N2O2 and a molecular weight of 444.53 g/mol. Its IUPAC name is 2-dibenzofuran-2-yl-4-(3-methylanilino)-1-(3-methylphenyl)-2H-pyrrol-5-one.
| Compound Name | 2-dibenzofuran-2-yl-4-(3-methylanilino)-1-(3-methylphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4916628 |
| Molecular Formula | C30H24N2O2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 2-dibenzofuran-2-yl-4-(3-methylanilino)-1-(3-methylphenyl)-2H-pyrrol-5-one |
| SMILES | Cc1cccc(NC2=CC(c3ccc4oc5ccccc5c4c3)N(c3cccc(C)c3)C2=O)c1 |
| InChI | InChI=1S/C30H24N2O2/c1-19-7-5-9-22(15-19)31-26-18-27(32(30(26)33)23-10-6-8-20(2)16-23)21-13-14-29-25(17-21)24-11-3-4-12-28(24)34-29/h3-18,27,31H,1-2H3 |
| InChIKey | WVSVUFLYUPAIKE-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |