C23H17ClN2O4 — CID 29012168
4-[[(2S)-2-(4-chlorophenyl)-5-oxo-1-phenyl-2H-pyrrol-4-yl]amino]-2-hydroxybenzoic acid (PubChem CID 29012168) has the molecular formula C23H17ClN2O4 and a molecular weight of 420.85 g/mol. Its IUPAC name is 4-[[(2S)-2-(4-chlorophenyl)-5-oxo-1-phenyl-2H-pyrrol-4-yl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[(2S)-2-(4-chlorophenyl)-5-oxo-1-phenyl-2H-pyrrol-4-yl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 29012168 |
| Molecular Formula | C23H17ClN2O4 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 4-[[(2S)-2-(4-chlorophenyl)-5-oxo-1-phenyl-2H-pyrrol-4-yl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(NC2=C[C@@H](c3ccc(Cl)cc3)N(c3ccccc3)C2=O)cc1O |
| InChI | InChI=1S/C23H17ClN2O4/c24-15-8-6-14(7-9-15)20-13-19(22(28)26(20)17-4-2-1-3-5-17)25-16-10-11-18(23(29)30)21(27)12-16/h1-13,20,25,27H,(H,29,30)/t20-/m0/s1 |
| InChIKey | DLYTUOOCTYXYNW-FQEVSTJZSA-N |
| XLogP | 4.83 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |