C24H16ClNO6 — CID 17036859
5-[(3Z)-2-(4-chlorophenyl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-2-hydroxybenzoic acid (PubChem CID 17036859) has the molecular formula C24H16ClNO6 and a molecular weight of 449.85 g/mol. Its IUPAC name is 5-[(3Z)-2-(4-chlorophenyl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-2-hydroxybenzoic acid.
| Compound Name | 5-[(3Z)-2-(4-chlorophenyl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 17036859 |
| Molecular Formula | C24H16ClNO6 |
| Molecular Weight | 449.85 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 5-[(3Z)-2-(4-chlorophenyl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-2-hydroxybenzoic acid |
| SMILES | O=C1C(=O)N(c2ccc(O)c(C(=O)O)c2)C(c2ccc(Cl)cc2)/C1=C(/O)c1ccccc1 |
| InChI | InChI=1S/C24H16ClNO6/c25-15-8-6-13(7-9-15)20-19(21(28)14-4-2-1-3-5-14)22(29)23(30)26(20)16-10-11-18(27)17(12-16)24(31)32/h1-12,20,27-28H,(H,31,32)/b21-19- |
| InChIKey | APOIUAYMBUQTHG-VZCXRCSSSA-N |
| XLogP | 4.37 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.85 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|