C24H16BrNO6 — CID 45105869
4-[(3Z)-2-(4-bromophenyl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-2-hydroxybenzoic acid (PubChem CID 45105869) has the molecular formula C24H16BrNO6 and a molecular weight of 494.30 g/mol. Its IUPAC name is 4-[(3Z)-2-(4-bromophenyl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-2-hydroxybenzoic acid.
| Compound Name | 4-[(3Z)-2-(4-bromophenyl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 45105869 |
| Molecular Formula | C24H16BrNO6 |
| Molecular Weight | 494.30 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | 4-[(3Z)-2-(4-bromophenyl)-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-2-hydroxybenzoic acid |
| SMILES | O=C1C(=O)N(c2ccc(C(=O)O)c(O)c2)C(c2ccc(Br)cc2)/C1=C(/O)c1ccccc1 |
| InChI | InChI=1S/C24H16BrNO6/c25-15-8-6-13(7-9-15)20-19(21(28)14-4-2-1-3-5-14)22(29)23(30)26(20)16-10-11-17(24(31)32)18(27)12-16/h1-12,20,27-28H,(H,31,32)/b21-19- |
| InChIKey | ALDGQZJKGCOBOM-VZCXRCSSSA-N |
| XLogP | 4.48 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.30 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|