C24H15BrN2O7 — CID 59051682
3-[(3E)-3-[(4-bromophenyl)-hydroxymethylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzoic acid (PubChem CID 59051682) has the molecular formula C24H15BrN2O7 and a molecular weight of 523.30 g/mol. Its IUPAC name is 3-[(3E)-3-[(4-bromophenyl)-hydroxymethylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzoic acid.
| Compound Name | 3-[(3E)-3-[(4-bromophenyl)-hydroxymethylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 59051682 |
| Molecular Formula | C24H15BrN2O7 |
| Molecular Weight | 523.30 g/mol |
| Exact Mass | 522.01 |
| IUPAC Name | 3-[(3E)-3-[(4-bromophenyl)-hydroxymethylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzoic acid |
| SMILES | O=C1C(=O)N(c2cccc(C(=O)O)c2)C(c2ccc([N+](=O)[O-])cc2)/C1=C(\O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H15BrN2O7/c25-16-8-4-14(5-9-16)21(28)19-20(13-6-10-17(11-7-13)27(33)34)26(23(30)22(19)29)18-3-1-2-15(12-18)24(31)32/h1-12,20,28H,(H,31,32)/b21-19+ |
| InChIKey | OZUQEWLJIUEUBY-XUTLUUPISA-N |
| XLogP | 4.68 |
| TPSA | 138.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|