C24H15BrN6O5 — CID 59051683
(4E)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(4-nitrophenyl)-1-[3-(2H-tetrazol-5-yl)phenyl]pyrrolidine-2,3-dione (PubChem CID 59051683) has the molecular formula C24H15BrN6O5 and a molecular weight of 547.33 g/mol. Its IUPAC name is (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(4-nitrophenyl)-1-[3-(2H-tetrazol-5-yl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(4-nitrophenyl)-1-[3-(2H-tetrazol-5-yl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 59051683 |
| Molecular Formula | C24H15BrN6O5 |
| Molecular Weight | 547.33 g/mol |
| Exact Mass | 546.03 |
| IUPAC Name | (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(4-nitrophenyl)-1-[3-(2H-tetrazol-5-yl)phenyl]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2cccc(-c3nn[nH]n3)c2)C(c2ccc([N+](=O)[O-])cc2)/C1=C(\O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H15BrN6O5/c25-16-8-4-14(5-9-16)21(32)19-20(13-6-10-17(11-7-13)31(35)36)30(24(34)22(19)33)18-3-1-2-15(12-18)23-26-28-29-27-23/h1-12,20,32H,(H,26,27,28,29)/b21-19+ |
| InChIKey | XEAZAKJNEGIKLP-XUTLUUPISA-N |
| XLogP | 4.16 |
| TPSA | 155.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|