C33H37N3O5 — CID 4916853
[2-[4-(dimethylamino)phenyl]-1-(2-morpholin-4-ium-4-ylethyl)-4,5-dioxopyrrolidin-3-ylidene]-[4-[(3-methylphenyl)methoxy]phenyl]methanolate (PubChem CID 4916853) has the molecular formula C33H37N3O5 and a molecular weight of 555.68 g/mol. Its IUPAC name is [2-[4-(dimethylamino)phenyl]-1-(2-morpholin-4-ium-4-ylethyl)-4,5-dioxopyrrolidin-3-ylidene]-[4-[(3-methylphenyl)methoxy]phenyl]methanolate.
| Compound Name | [2-[4-(dimethylamino)phenyl]-1-(2-morpholin-4-ium-4-ylethyl)-4,5-dioxopyrrolidin-3-ylidene]-[4-[(3-methylphenyl)methoxy]phenyl]methanolate |
|---|---|
| PubChem CID | 4916853 |
| Molecular Formula | C33H37N3O5 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | [2-[4-(dimethylamino)phenyl]-1-(2-morpholin-4-ium-4-ylethyl)-4,5-dioxopyrrolidin-3-ylidene]-[4-[(3-methylphenyl)methoxy]phenyl]methanolate |
| SMILES | Cc1cccc(COc2ccc(C([O-])=C3C(=O)C(=O)N(CC[NH+]4CCOCC4)C3c3ccc(N(C)C)cc3)cc2)c1 |
| InChI | InChI=1S/C33H37N3O5/c1-23-5-4-6-24(21-23)22-41-28-13-9-26(10-14-28)31(37)29-30(25-7-11-27(12-8-25)34(2)3)36(33(39)32(29)38)16-15-35-17-19-40-20-18-35/h4-14,21,30,37H,15-20,22H2,1-3H3 |
| InChIKey | JHKXKKPCGCMLGW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|