C33H36N2O6 — CID 4977324
[2-(4-methoxyphenyl)-1-(3-morpholin-4-ium-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]-[4-[(3-methylphenyl)methoxy]phenyl]methanolate (PubChem CID 4977324) has the molecular formula C33H36N2O6 and a molecular weight of 556.66 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-1-(3-morpholin-4-ium-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]-[4-[(3-methylphenyl)methoxy]phenyl]methanolate.
| Compound Name | [2-(4-methoxyphenyl)-1-(3-morpholin-4-ium-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]-[4-[(3-methylphenyl)methoxy]phenyl]methanolate |
|---|---|
| PubChem CID | 4977324 |
| Molecular Formula | C33H36N2O6 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | [2-(4-methoxyphenyl)-1-(3-morpholin-4-ium-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]-[4-[(3-methylphenyl)methoxy]phenyl]methanolate |
| SMILES | COc1ccc(C2C(=C([O-])c3ccc(OCc4cccc(C)c4)cc3)C(=O)C(=O)N2CCC[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C33H36N2O6/c1-23-5-3-6-24(21-23)22-41-28-13-9-26(10-14-28)31(36)29-30(25-7-11-27(39-2)12-8-25)35(33(38)32(29)37)16-4-15-34-17-19-40-20-18-34/h3,5-14,21,30,36H,4,15-20,22H2,1-2H3 |
| InChIKey | KFAKDBOVAUYAJF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|